CAS 73499-58-8
:2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1->4)-[beta-D-galactopyranosyl-(1->3)]-2-(acetylamino)-2-deoxy-D-galactose
Description:
The chemical substance known as "2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1->4)-[beta-D-galactopyranosyl-(1->3)]-2-(acetylamino)-2-deoxy-D-galactose," with the CAS number 73499-58-8, is a complex glycosylated compound. It features a disaccharide structure composed of glucopyranose and galactopyranose units, linked through specific glycosidic bonds. The presence of acetylamino groups indicates that it is an N-acetyl derivative, which can influence its solubility and biological activity. This compound is likely to exhibit properties typical of glycosides, such as being soluble in water and having potential interactions with biological macromolecules, including proteins and enzymes. Its structural complexity suggests potential applications in biochemistry, particularly in studies related to cell signaling, immunology, or as a component in drug design. The specific stereochemistry and functional groups present in the molecule contribute to its reactivity and interactions in various chemical and biological environments.
Formula:C22H38N2O16
InChI:InChI=1/C22H38N2O16/c1-7(29)23-9(3-25)19(39-22-18(36)17(35)15(33)12(6-28)38-22)20(10(31)4-26)40-21-13(24-8(2)30)16(34)14(32)11(5-27)37-21/h3,9-22,26-28,31-36H,4-6H2,1-2H3,(H,23,29)(H,24,30)/t9-,10+,11+,12+,13+,14+,15-,16+,17-,18+,19+,20-,21-,22-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
