CAS 735-40-0

ethyl N-[2-nitro-4-(trifluoromethyl)phenyl]glycinate

Description:

Ethyl N-[2-nitro-4-(trifluoromethyl)phenyl]glycinate, with the CAS number 735-40-0, is a chemical compound characterized by its unique structure, which includes an ethyl ester group, a nitro group, and a trifluoromethyl substituent on a phenyl ring. This compound typically exhibits properties associated with both its functional groups and aromatic nature, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Ethyl N-[2-nitro-4-(trifluoromethyl)phenyl]glycinate may also display specific optical activity due to its chiral center, which can be relevant in the context of pharmacological applications. Overall, this compound's characteristics make it a subject of interest for research in various fields, including organic synthesis and drug development.

Formula: C₁₁H₁₁F₃N₂O₄

InChI: InChI=1/C11H11F3N2O4/c1-2-20-10(17)6-15-8-4-3-7(11(12,13)14)5-9(8)16(18)19/h3-5,15H,2,6H2,1H3

SMILES: CCOC(=O)CNc1ccc(cc1N(=O)=O)C(F)(F)F

Ethyl 2-(2-nitro-4-trifluoromethylphenylamino)acetate

CAS: 735-40-0

Formula: C₁₁H₁₁F₃N₂O₄

Molecular weight: 292.2112

Ref: IN-DA003Q1H

Ethyl {[2-nitro-4-(trifluoromethyl)phenyl]amino}acetate

CAS: 735-40-0

Ethyl {[2-nitro-4-(trifluoromethyl)phenyl]amino}acetate

Purity: ≥95%

Molecular weight: 292.21g/mol

Ref: 54-PC3350