
CAS 73502-05-3
:2-(Bromomethyl)-4-methoxy-1-methylbenzene
Description:
2-(Bromomethyl)-4-methoxy-1-methylbenzene, also known by its CAS number 73502-05-3, is an organic compound characterized by the presence of a bromomethyl group and a methoxy group attached to a methyl-substituted benzene ring. This compound features a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The methoxy group (-OCH3) enhances the electron density of the aromatic ring, influencing its reactivity and making it a potential candidate for various chemical transformations. The presence of the methyl group further modifies the electronic properties of the compound. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents is generally good, while its solubility in water is limited due to the hydrophobic nature of the aromatic system. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups that allow for further chemical modifications.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-7-3-4-9(11-2)5-8(7)6-10/h3-5H,6H2,1-2H3
InChI key:InChIKey=JPEOGQYRFFUNJO-UHFFFAOYSA-N
SMILES:C(Br)C1=CC(OC)=CC=C1C
Synonyms:- Benzene, 2-(bromomethyl)-4-methoxy-1-methyl-
- 2-(Bromomethyl)-4-methoxy-1-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.