CAS 73509-46-3
:(5Z)-7-{(2R,3R)-3-[(1E)-3-hydroxyoct-1-en-1-yl]bicyclo[3.1.1]hept-2-yl}hept-5-enoic acid
Description:
The chemical substance known as (5Z)-7-{(2R,3R)-3-[(1E)-3-hydroxyoct-1-en-1-yl]bicyclo[3.1.1]hept-2-yl}hept-5-enoic acid, with the CAS number 73509-46-3, is a complex organic compound characterized by its unique bicyclic structure and specific stereochemistry. This compound features a heptenoic acid backbone, which includes a double bond and a carboxylic acid functional group, contributing to its reactivity and potential biological activity. The presence of a hydroxyl group and a long aliphatic chain indicates that it may exhibit hydrophilic and lipophilic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The stereochemical configuration, particularly the (2R,3R) and (5Z) designations, suggests that the compound may have specific interactions with biological targets, influencing its efficacy and safety profile. Overall, this substance represents a fascinating example of the complexity found in organic chemistry, with implications for its behavior in biological systems and potential utility in synthetic applications.
Formula:C22H36O3
InChI:InChI=1/C22H36O3/c1-2-3-6-9-20(23)13-12-18-14-17-15-19(16-17)21(18)10-7-4-5-8-11-22(24)25/h4,7,12-13,17-21,23H,2-3,5-6,8-11,14-16H2,1H3,(H,24,25)/b7-4-,13-12+/t17?,18-,19?,20?,21-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ono 11006
CAS:Ono 11006 is a thromboxane agonist that dose dependently reduced the positive inotropic effect induced by field stimulation.Formula:C22H36O3Color and Shape:SolidMolecular weight:348.52
