CymitQuimica logo

CAS 73511-58-7

:

4-phenyl-5-[(quinolin-8-yloxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:
4-Phenyl-5-[(quinolin-8-yloxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic ring containing three nitrogen atoms. This compound features a phenyl group and a quinoline moiety, contributing to its potential biological activity and interaction with various biological targets. The presence of the thione functional group (–C=S) indicates that it may exhibit properties typical of thioketones, such as reactivity towards electrophiles. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its diverse functional groups that may facilitate interactions with biological systems. Additionally, the quinoline derivative may impart specific pharmacological properties, making it of interest in drug discovery. Its CAS number, 73511-58-7, allows for easy identification and retrieval of information regarding its properties, synthesis, and potential applications in scientific literature and databases.
Formula:C18H14N4OS
InChI:InChI=1/C18H14N4OS/c24-18-21-20-16(22(18)14-8-2-1-3-9-14)12-23-15-10-4-6-13-7-5-11-19-17(13)15/h1-11H,12H2,(H,21,24)
Synonyms:
  • 4H-1,2,4-triazole-3-thiol, 4-phenyl-5-[(8-quinolinyloxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.