CAS 735256-11-8
:(R)-3-Amino-4-(2-fluorophenyl)butyric acid
Description:
(R)-3-Amino-4-(2-fluorophenyl)butyric acid, with the CAS number 735256-11-8, is a chiral amino acid derivative characterized by the presence of a fluorophenyl group. This compound features a central carbon atom bonded to an amino group, a carboxylic acid group, and a side chain that includes a fluorinated aromatic ring. The (R) configuration indicates the specific spatial arrangement of its substituents, which can influence its biological activity and interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in the development of pharmaceuticals targeting neurological disorders. Its fluorine atom may enhance lipophilicity and metabolic stability, making it a valuable candidate for drug design. Additionally, the presence of both an amino and a carboxylic acid functional group allows for various chemical modifications, which can be exploited to optimize its pharmacological properties. Overall, (R)-3-Amino-4-(2-fluorophenyl)butyric acid exemplifies the complexity and utility of amino acid derivatives in therapeutic contexts.
Formula:C10H12FNO2
InChI:InChI=1/C10H12FNO2/c11-9-4-2-1-3-7(9)5-8(12)6-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m1/s1
SMILES:c1ccc(c(c1)C[C@H](CC(=O)O)N)F
Synonyms:- (3R)-3-Amino-4-(2-fluorophenyl)butanoic acid
- benzenebutanoic acid, beta-amino-2-fluoro-, (betaR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
