CAS 735269-68-8
:(1R,3S)-3-(2-methylbenzoyl)cyclohexane-1-carboxylic acid
Description:
(1R,3S)-3-(2-methylbenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,3S) configuration. This compound features a cyclohexane ring substituted with a carboxylic acid group and a 2-methylbenzoyl moiety, contributing to its potential biological activity and solubility properties. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. The aromatic 2-methylbenzoyl group enhances the compound's lipophilicity, which may influence its interaction with biological membranes and receptors. Additionally, the stereochemistry of the compound can significantly affect its pharmacological properties, including its binding affinity and efficacy in biological systems. As a result, this compound may be of interest in medicinal chemistry and drug development, particularly in the design of chiral pharmaceuticals. Its CAS number, 735269-68-8, allows for easy identification and reference in chemical databases and literature.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-10-5-2-3-8-13(10)14(16)11-6-4-7-12(9-11)15(17)18/h2-3,5,8,11-12H,4,6-7,9H2,1H3,(H,17,18)/t11-,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.