CAS 735269-73-5
:(1R,3S)-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 735269-73-5, is a chiral compound characterized by its cyclohexane backbone and functional groups that include a carboxylic acid and a methoxybenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,3S) configuration, which can influence its biological activity and interactions. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound may also exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Overall, the unique combination of its stereochemistry and functional groups contributes to its chemical behavior and potential utility in various fields, including pharmaceuticals and organic synthesis.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-19-13-7-5-10(6-8-13)14(16)11-3-2-4-12(9-11)15(17)18/h5-8,11-12H,2-4,9H2,1H3,(H,17,18)/t11-,12+/m0/s1
Synonyms:- (1R,3S)-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid
- CIS-3-(4-METHOXYBENZOYL)CYCLOHEXANE-1-CARBOXYLIC ACID
- Cyclohexanecarboxylic acid, 3-(4-methoxybenzoyl)-, (1R,3S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.