CAS 735269-76-8

(1R,3S)-3-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid

Description:

(1R,3S)-3-(2-ethylbenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,3S) configuration. This compound features a cyclohexane ring substituted with a carboxylic acid group and a 2-ethylbenzoyl moiety, which contributes to its unique physical and chemical properties. The presence of the carboxylic acid functional group suggests that it can participate in hydrogen bonding, influencing its solubility and reactivity. The bulky 2-ethylbenzoyl group may affect the compound's steric hindrance and overall molecular conformation, impacting its biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical applications due to its potential biological properties, which could be influenced by its stereochemistry. Additionally, the CAS number 735269-76-8 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-2-11-6-3-4-9-14(11)15(17)12-7-5-8-13(10-12)16(18)19/h3-4,6,9,12-13H,2,5,7-8,10H2,1H3,(H,18,19)/t12-,13+/m0/s1