CAS 735269-77-9

(1R,3S)-3-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-(4-ethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 735269-77-9, is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a 4-ethylbenzoyl substituent. This compound exhibits specific stereochemistry, indicated by the (1R,3S) configuration, which influences its physical and chemical properties, including solubility, reactivity, and biological activity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may form salts or esters. The aromatic 4-ethylbenzoyl group contributes to the compound's hydrophobic characteristics, potentially affecting its interactions in biological systems. Such compounds may be of interest in pharmaceutical applications, particularly in drug design and development, due to their potential biological activity and ability to interact with various biological targets. Overall, the unique structural features of this compound make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-2-11-6-8-12(9-7-11)15(17)13-4-3-5-14(10-13)16(18)19/h6-9,13-14H,2-5,10H2,1H3,(H,18,19)/t13-,14+/m0/s1