CymitQuimica logo

CAS 735269-78-0

:

(1R,3S)-3-(3-chlorobenzoyl)cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(3-chlorobenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 735269-78-0, is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a chlorobenzoyl substituent. This compound exhibits specific stereochemistry, indicated by the (1R,3S) configuration, which influences its physical and chemical properties, including solubility, reactivity, and biological activity. The presence of the chlorobenzoyl group suggests potential applications in pharmaceuticals or agrochemicals, as such moieties are often associated with bioactive compounds. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the chlorinated aromatic ring may enhance the compound's lipophilicity and influence its interaction with biological targets. Overall, this compound's unique structural features make it of interest in various fields, including medicinal chemistry and materials science.
Formula:C14H15ClO3
InChI:InChI=1/C14H15ClO3/c15-12-6-2-4-10(8-12)13(16)9-3-1-5-11(7-9)14(17)18/h2,4,6,8-9,11H,1,3,5,7H2,(H,17,18)/t9-,11+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.