CAS 735269-79-1

rel-(1R,3S)-3-(4-Chlorobenzoyl)cyclohexanecarboxylic acid

Description:

Rel-(1R,3S)-3-(4-Chlorobenzoyl)cyclohexanecarboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a 4-chlorobenzoyl substituent. The presence of the chiral centers at the 1 and 3 positions of the cyclohexane ring contributes to its stereochemistry, influencing its reactivity and interactions in biological systems. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its chlorobenzoyl group enhances lipophilicity, potentially affecting its solubility and permeability in biological membranes. The carboxylic acid group provides acidic properties, allowing for potential interactions with various biological targets. The specific stereochemistry can also play a crucial role in the compound's pharmacodynamics and pharmacokinetics, making it an important consideration in drug design. Overall, rel-(1R,3S)-3-(4-Chlorobenzoyl)cyclohexanecarboxylic acid exemplifies the significance of molecular structure in determining the behavior of chemical substances in biological contexts.

Formula: C₁₄H₁₅ClO₃

InChI: InChI=1/C14H15ClO3/c15-12-6-4-9(5-7-12)13(16)10-2-1-3-11(8-10)14(17)18/h4-7,10-11H,1-3,8H2,(H,17,18)/t10-,11+/s2

InChI key: InChIKey=RUYKAHCJBCRSKL-WIBLRKLZNA-N

SMILES: C(=O)([C@H]1C[C@@H](C(O)=O)CCC1)C2=CC=C(Cl)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 3-(4-chlorobenzoyl)-, (1R,3S)-rel-
• rel-(1R,3S)-3-(4-Chlorobenzoyl)cyclohexanecarboxylic acid