CAS 735269-80-4
:(1R,3S)-3-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid
Description:
(1R,3S)-3-(3-fluorobenzoyl)cyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a fluorobenzoyl substituent. The presence of the fluorine atom in the benzoyl group can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and altering its interaction with biological targets. The specific stereochemistry, indicated by the (1R,3S) configuration, suggests that the compound may exhibit unique properties compared to its enantiomers, including differences in solubility, melting point, and pharmacological effects. This compound may be of interest in medicinal chemistry and drug development due to its potential applications in therapeutic agents. Its molecular structure allows for various interactions, making it a candidate for studies in areas such as drug design and synthesis. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C14H15FO3
InChI:InChI=1/C14H15FO3/c15-12-6-2-4-10(8-12)13(16)9-3-1-5-11(7-9)14(17)18/h2,4,6,8-9,11H,1,3,5,7H2,(H,17,18)/t9-,11+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.