CAS 735269-92-8

cis-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid

Description:

Cis-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structural features, which include a cyclohexane ring substituted with a carboxylic acid group and a methoxybenzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are oriented on the same side, which can influence the compound's physical and chemical properties, such as its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (cyclohexane and methoxybenzene) and hydrophilic (carboxylic acid) functional groups. It may participate in hydrogen bonding due to the carboxylic acid group, affecting its interactions in various solvents. Additionally, the methoxy group can enhance the compound's lipophilicity, potentially influencing its biological activity. Overall, cis-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid is of interest in fields such as medicinal chemistry and materials science, where its structural characteristics may be leveraged for specific applications.

Formula: C₁₅H₁₈O₄

InChI: InChI=1/C15H18O4/c1-19-13-5-3-2-4-12(13)14(16)10-6-8-11(9-7-10)15(17)18/h2-5,10-11H,6-9H2,1H3,(H,17,18)/t10-,11+

InChI key: InChIKey=NMSIFNFDZHKEGS-PHIMTYICNA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• cis-4-(2-Methoxybenzoyl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-(2-methoxybenzoyl)-, cis-