CAS 735269-93-9

cis-4-(3-Methoxybenzoyl)cyclohexanecarboxylic acid

Description:

Cis-4-(3-Methoxybenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structural features, which include a cyclohexane ring substituted with a carboxylic acid group and a methoxybenzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are positioned on the same side, influencing the compound's spatial arrangement and potentially its reactivity and interactions. This compound is likely to exhibit moderate solubility in organic solvents due to the presence of the methoxy group, which can enhance its lipophilicity. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the presence of the aromatic methoxybenzoyl group may impart specific electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its structural features can be leveraged for specific applications.

Formula: C₁₅H₁₈O₄

InChI: InChI=1/C15H18O4/c1-19-13-4-2-3-12(9-13)14(16)10-5-7-11(8-6-10)15(17)18/h2-4,9-11H,5-8H2,1H3,(H,17,18)/t10-,11+

InChI key: InChIKey=HJLPLLKWHYGMNZ-PHIMTYICNA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• cis-4-(3-Methoxybenzoyl)cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-(3-methoxybenzoyl)-, cis-