CAS 735270-06-1
:cis-4-(3-Bromobenzoyl)cyclohexanecarboxylic acid
Description:
Cis-4-(3-Bromobenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure, which is substituted with a carboxylic acid group and a bromobenzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are positioned on the same side, influencing the compound's spatial arrangement and potentially its reactivity and interactions. The presence of the bromobenzoyl group introduces both a bromine atom and a carbonyl functionality, which can enhance the compound's electrophilic character and may facilitate various chemical reactions, such as nucleophilic attacks. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic cyclohexane ring and the presence of the bulky bromobenzoyl group. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and material science. As with many organic compounds, proper handling and storage are essential to ensure safety and stability.
Formula:C14H15BrO3
InChI:InChI=1/C14H15BrO3/c15-12-3-1-2-11(8-12)13(16)9-4-6-10(7-5-9)14(17)18/h1-3,8-10H,4-7H2,(H,17,18)/t9-,10+
InChI key:InChIKey=PNLUUWXXVKDKPP-AOOOYVTPNA-N
SMILES:C(=O)([C@H]1CC[C@@H](C(O)=O)CC1)C2=CC(Br)=CC=C2
Synonyms:- cis-4-(3-Bromobenzoyl)cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 4-(3-bromobenzoyl)-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.