CAS 735270-16-3

cis-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid

Description:

Cis-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure, which is substituted with a carboxylic acid group and a fluorobenzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are positioned on the same side, influencing its spatial arrangement and potentially its reactivity and interactions. The presence of the fluorobenzoyl group introduces both electron-withdrawing characteristics due to the fluorine atom and steric effects that can affect the compound's solubility and boiling point. This compound may exhibit interesting properties such as acidity due to the carboxylic acid functional group, and it may participate in hydrogen bonding, which can influence its physical state and solubility in various solvents. Additionally, its unique structure may confer specific biological activities, making it of interest in pharmaceutical research. Overall, the compound's characteristics are defined by its functional groups, stereochemistry, and molecular interactions.

Formula: C₁₄H₁₅FO₃

InChI: InChI=1/C14H15FO3/c15-12-7-5-10(6-8-12)13(16)9-1-3-11(4-2-9)14(17)18/h5-9,11H,1-4H2,(H,17,18)/t9-,11+

InChI key: InChIKey=UNBXJGIVEWFNMT-JGZJWPJONA-N

SMILES: C(=O)([C@H]1CC[C@@H](C(O)=O)CC1)C2=CC=C(F)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(4-fluorobenzoyl)-, cis-
• cis-4-(4-Fluorobenzoyl)cyclohexanecarboxylic acid