CAS 735270-21-0
:cis-4-(2,3-Dimethylbenzoyl)cyclohexanecarboxylic acid
Description:
Cis-4-(2,3-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structural features, which include a cyclohexane ring substituted with a carboxylic acid group and a benzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are oriented on the same side, influencing its spatial arrangement and potentially its reactivity. The presence of the 2,3-dimethylbenzoyl group contributes to its hydrophobic characteristics and may affect its solubility in various solvents. This compound may exhibit interesting properties such as potential biological activity or utility in synthetic applications, particularly in organic synthesis or as an intermediate in the production of pharmaceuticals. Its molecular interactions, stability, and reactivity can be influenced by the steric and electronic effects of the substituents. As with many organic acids, it may participate in acid-base reactions and could be involved in various chemical transformations. Safety and handling precautions should be observed due to the potential hazards associated with organic compounds.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-4-3-5-14(11(10)2)15(17)12-6-8-13(9-7-12)16(18)19/h3-5,12-13H,6-9H2,1-2H3,(H,18,19)/t12-,13+
InChI key:InChIKey=BVCKZKSLDGWWPU-BETUJISGNA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2
Synonyms:- Cyclohexanecarboxylic acid, 4-(2,3-dimethylbenzoyl)-, cis-
- cis-4-(2,3-Dimethylbenzoyl)cyclohexanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.