CAS 735270-25-4

cis-4-(3,4-Dimethylbenzoyl)cyclohexanecarboxylic acid

Description:

Cis-4-(3,4-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structural features, including a cyclohexane ring and a carboxylic acid functional group. The presence of the 3,4-dimethylbenzoyl moiety contributes to its aromatic characteristics and influences its reactivity and solubility. This compound typically exhibits a solid state at room temperature and may have specific melting and boiling points that reflect its molecular structure. Its cis configuration indicates that the substituents on the cyclohexane ring are oriented on the same side, which can affect its stereochemistry and potential interactions with biological systems. The carboxylic acid group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, this compound may exhibit interesting photochemical properties due to the presence of the aromatic group, making it potentially useful in various applications, including pharmaceuticals and materials science. As with many organic compounds, safety and handling precautions should be observed, given its potential reactivity and toxicity.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-10-3-4-14(9-11(10)2)15(17)12-5-7-13(8-6-12)16(18)19/h3-4,9,12-13H,5-8H2,1-2H3,(H,18,19)/t12-,13+

InChI key: InChIKey=ZFFJLVSAFRDMEO-BETUJISGNA-N

SMILES: C(=O)(C1=CC(C)=C(C)C=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• Cyclohexanecarboxylic acid, 4-(3,4-dimethylbenzoyl)-, cis-
• cis-4-(3,4-Dimethylbenzoyl)cyclohexanecarboxylic acid