CAS 735270-26-5
:cis-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid
Description:
Cis-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid is an organic compound characterized by its unique structural features, which include a cyclohexane ring substituted with a carboxylic acid group and a benzoyl moiety. The "cis" configuration indicates that the substituents on the cyclohexane ring are oriented on the same side, influencing its spatial arrangement and potentially its reactivity. The presence of the 3,5-dimethylbenzoyl group contributes to its hydrophobic characteristics, while the carboxylic acid group imparts acidic properties, allowing for potential interactions in various chemical environments. This compound may exhibit interesting properties such as solubility in organic solvents and varying degrees of stability depending on the conditions. Its unique structure suggests potential applications in fields such as pharmaceuticals, materials science, or as a chemical intermediate. However, specific reactivity, stability, and application details would require further investigation through experimental studies or literature review.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-7-11(2)9-14(8-10)15(17)12-3-5-13(6-4-12)16(18)19/h7-9,12-13H,3-6H2,1-2H3,(H,18,19)/t12-,13+
InChI key:InChIKey=SBGJTNCBQFWRCF-BETUJISGNA-N
SMILES:C(=O)(C1=CC(C)=CC(C)=C1)[C@H]2CC[C@@H](C(O)=O)CC2
Synonyms:- Cyclohexanecarboxylic acid, 4-(3,5-dimethylbenzoyl)-, cis-
- cis-4-(3,5-Dimethylbenzoyl)cyclohexanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.