CAS 735274-65-4

rel-(1R,2R)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Rel-(1R,2R)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a cyclohexane ring with a carboxylic acid group, which contributes to its acidity and potential reactivity. The presence of a nitrophenyl group indicates that the compound may exhibit significant electronic effects, influencing its reactivity and interaction with biological systems. The oxoethyl moiety suggests potential for further chemical transformations, making it a candidate for various synthetic applications. This compound may also exhibit specific solubility characteristics based on its functional groups, affecting its behavior in different solvents. Additionally, the stereochemical configuration (1R,2R) implies that the compound may have distinct spatial arrangements, which can influence its biological activity and interactions with other molecules. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and material science.

Formula: C₁₅H₁₇NO₅

InChI: InChI=1/C15H17NO5/c17-14(12-7-3-4-8-13(12)16(20)21)9-10-5-1-2-6-11(10)15(18)19/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,18,19)/t10-,11-/s2

InChI key: InChIKey=DHPJGNQYQNOIGF-DUJBIPCPNA-N

SMILES: C(C(=O)C1=C(N(=O)=O)C=CC=C1)[C@H]2[C@@H](C(O)=O)CCCC2

Synonyms:

• rel-(1R,2R)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 2-[2-(2-nitrophenyl)-2-oxoethyl]-, (1R,2R)-rel-