CAS 735274-73-4

(1R,2S)-2-[2-(2-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-[2-(2-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-73-4, is characterized by its specific stereochemistry, indicated by the (1R,2S) configuration, which suggests a particular spatial arrangement of its atoms that can influence its biological activity and reactivity. This compound features a cyclohexane ring, which contributes to its rigidity and potential interactions with biological targets. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. Additionally, the methoxyphenyl group suggests potential for aromatic interactions, which can be significant in drug design and molecular recognition processes. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and related fields. Further studies would be necessary to elucidate its complete profile, including its reactivity, stability, and potential applications.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-15-9-5-4-8-13(15)14(17)10-11-6-2-3-7-12(11)16(18)19/h4-5,8-9,11-12H,2-3,6-7,10H2,1H3,(H,18,19)/t11-,12+/m0/s1