CymitQuimica logo

CAS 735274-75-6

:

(1R,2S)-2-[2-(3-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-[2-(3-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-75-6, is characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclohexane ring, which contributes to its three-dimensional structure and potential interactions with biological systems. The presence of a carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the methoxyphenyl group introduces aromaticity and may enhance the compound's lipophilicity, affecting its pharmacokinetic properties. The ketone functionality within the molecule indicates potential reactivity, particularly in nucleophilic addition reactions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and functional groups that can interact with biological targets.
Formula:C16H20O4
InChI:InChI=1/C16H20O4/c1-20-13-7-4-6-12(9-13)15(17)10-11-5-2-3-8-14(11)16(18)19/h4,6-7,9,11,14H,2-3,5,8,10H2,1H3,(H,18,19)/t11-,14+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.