CAS 735274-85-8

(1R,2S)-2-[2-(3-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-[2-(3-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-85-8, is a chiral compound characterized by its cyclohexane backbone and the presence of a carboxylic acid functional group. This compound features a bromophenyl substituent, which contributes to its potential biological activity and lipophilicity. The stereochemistry indicated by the (1R,2S) configuration suggests specific spatial arrangements of its atoms, which can influence its reactivity and interaction with biological targets. The presence of the keto group (2-oxo) further adds to its chemical reactivity, potentially allowing for various chemical transformations. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart unique pharmacological properties. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further investigation in synthetic and biological contexts.

Formula: C₁₅H₁₇BrO₃

InChI: InChI=1/C15H17BrO3/c16-12-6-3-5-11(8-12)14(17)9-10-4-1-2-7-13(10)15(18)19/h3,5-6,8,10,13H,1-2,4,7,9H2,(H,18,19)/t10-,13+/m0/s1