CAS 735274-88-1
:(1R,2S)-2-[2-(4-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-[2-(4-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-88-1, is a chiral compound characterized by its cyclohexane backbone and the presence of a carboxylic acid functional group. This compound features a bromophenyl moiety, which contributes to its potential biological activity and lipophilicity. The specific stereochemistry indicated by the (1R,2S) configuration suggests that it has distinct spatial arrangements that can influence its reactivity and interactions with biological targets. The presence of the ketone group (2-oxo) further adds to its chemical reactivity. Such compounds are often of interest in medicinal chemistry due to their potential as pharmaceuticals or intermediates in drug synthesis. The bromine substituent can enhance the compound's pharmacological properties, including its ability to interact with various biological receptors or enzymes. Overall, this compound exemplifies the complexity and diversity of organic molecules used in chemical research and development.
Formula:C15H17BrO3
InChI:InChI=1/C15H17BrO3/c16-12-7-5-10(6-8-12)14(17)9-11-3-1-2-4-13(11)15(18)19/h5-8,11,13H,1-4,9H2,(H,18,19)/t11-,13+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.