CAS 735274-91-6

(1R,2S)-2-[2-(4-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-[2-(4-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-91-6, is a chiral compound characterized by its cyclohexane backbone and the presence of a carboxylic acid functional group. This compound features a fluorophenyl substituent, which contributes to its potential biological activity and lipophilicity. The specific stereochemistry indicated by the (1R,2S) configuration suggests that it may exhibit unique interactions in biological systems, making it of interest in pharmaceutical research. The presence of the ketone group (2-oxo) further enhances its reactivity and potential for forming various derivatives. As a carboxylic acid, it is expected to exhibit acidic properties, influencing its solubility and reactivity in different environments. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.

Formula: C₁₅H₁₇FO₃

InChI: InChI=1/C15H17FO3/c16-12-7-5-10(6-8-12)14(17)9-11-3-1-2-4-13(11)15(18)19/h5-8,11,13H,1-4,9H2,(H,18,19)/t11-,13+/m0/s1