CAS 735274-93-8
:(1R,2S)-2-[2-(2-chlorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-[2-(2-chlorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735274-93-8, is characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclohexane ring, which contributes to its cyclic structure and potential conformational flexibility. The presence of a carboxylic acid functional group (-COOH) suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The 2-(2-chlorophenyl)-2-oxo-ethyl substituent introduces both aromatic and halogen functionalities, which can enhance the compound's biological activity and lipophilicity. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for interactions with biological targets. Overall, its unique combination of cyclic and aromatic components, along with the carboxylic acid group, positions it as a potentially valuable compound in medicinal chemistry and related fields.
Formula:C15H17ClO3
InChI:InChI=1/C15H17ClO3/c16-13-8-4-3-7-12(13)14(17)9-10-5-1-2-6-11(10)15(18)19/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,18,19)/t10-,11+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.