CAS 735275-01-1
:rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
Description:
Rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a cyclohexane ring with a carboxylic acid group, which contributes to its acidity and potential reactivity. The presence of a nitrophenyl group indicates that the compound may exhibit significant electronic effects, potentially influencing its reactivity and interactions with biological targets. The oxoethyl moiety suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or as a biochemical probe. Its stereochemistry (1R,2S) implies specific spatial arrangements that can affect its biological activity and interactions with enzymes or receptors. Overall, this compound's unique structure and functional groups make it a candidate for further investigation in chemical and pharmaceutical research.
Formula:C15H17NO5
InChI:InChI=1/C15H17NO5/c17-14(12-7-3-4-8-13(12)16(20)21)9-10-5-1-2-6-11(10)15(18)19/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,18,19)/t10-,11+/s2
InChI key:InChIKey=DHPJGNQYQNOIGF-WIBLRKLZNA-N
SMILES:C(C(=O)C1=C(N(=O)=O)C=CC=C1)[C@H]2[C@H](C(O)=O)CCCC2
Synonyms:- rel-(1R,2S)-2-[2-(2-Nitrophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 2-[2-(2-nitrophenyl)-2-oxoethyl]-, (1R,2S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.