CAS 735275-02-2
:(1R,2S)-2-[2-(3-nitrophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-[2-(3-nitrophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-02-2, is characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclohexane ring substituted with a carboxylic acid group and a 3-nitrophenyl group linked through a 2-oxoethyl moiety. The presence of the nitrophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the electron-withdrawing nature of the nitro group, which can influence the compound's reactivity and biological activity. The carboxylic acid functional group contributes to its solubility in polar solvents and may play a role in its interaction with biological targets. Additionally, the compound's structural complexity and stereochemistry may affect its pharmacokinetics and pharmacodynamics, making it a subject of interest in drug design and development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in organic chemistry.
Formula:C15H17NO5
InChI:InChI=1/C15H17NO5/c17-14(11-5-3-6-12(8-11)16(20)21)9-10-4-1-2-7-13(10)15(18)19/h3,5-6,8,10,13H,1-2,4,7,9H2,(H,18,19)/t10-,13+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.