CAS 735275-04-4

(1R,3S)-3-phenacylcyclohexane-1-carboxylic acid

Description:

(1R,3S)-3-phenacylcyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group and a phenacyl substituent. The specific stereochemistry indicated by the (1R,3S) notation suggests that the molecule has distinct spatial arrangements at the first and third carbon atoms of the cyclohexane ring, contributing to its potential biological activity and interactions. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the phenacyl group can also impart unique characteristics, potentially affecting the compound's pharmacological properties. As a chiral molecule, it may exist in two enantiomeric forms, which can have different biological effects. Overall, (1R,3S)-3-phenacylcyclohexane-1-carboxylic acid is of interest in fields such as medicinal chemistry and organic synthesis due to its structural complexity and potential applications.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c16-14(12-6-2-1-3-7-12)10-11-5-4-8-13(9-11)15(17)18/h1-3,6-7,11,13H,4-5,8-10H2,(H,17,18)/t11-,13+/m0/s1