CAS 735275-05-5
:(1R,3S)-3-[2-(o-tolyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-[2-(o-tolyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-05-5, is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group at the 1-position and a substituent at the 3-position. The presence of the o-tolyl group indicates that there is a toluene derivative attached to the cyclohexane, contributing to its hydrophobic characteristics. The compound's stereochemistry, denoted by the (1R,3S) configuration, suggests specific spatial arrangements of its atoms, which can influence its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, its behavior in various environments can be influenced by factors such as pH, temperature, and the presence of other chemical species.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-11-5-2-3-8-14(11)15(17)10-12-6-4-7-13(9-12)16(18)19/h2-3,5,8,12-13H,4,6-7,9-10H2,1H3,(H,18,19)/t12-,13+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.