CAS 735275-07-7

(1R,3S)-3-[2-oxo-2-(p-tolyl)ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-oxo-2-(p-tolyl)ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-07-7, is a chiral compound characterized by its cyclohexane ring structure, which is substituted at specific positions. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The compound also features a ketone group (2-oxo) and a p-tolyl group, which contributes to its hydrophobic characteristics and potential interactions in biological systems. The stereochemistry, denoted by the (1R,3S) configuration, suggests that the compound can exhibit specific optical activity, which may influence its biological activity and interactions with enzymes or receptors. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for drug design and development. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-11-5-7-13(8-6-11)15(17)10-12-3-2-4-14(9-12)16(18)19/h5-8,12,14H,2-4,9-10H2,1H3,(H,18,19)/t12-,14+/m0/s1