CAS 735275-09-9

(1R,3S)-3-[2-(3-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-(3-methoxyphenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-09-9, is characterized by its specific stereochemistry, indicated by the (1R,3S) configuration, which suggests that it has distinct spatial arrangements of its atoms that can influence its biological activity and interactions. This compound features a cyclohexane ring, which contributes to its rigidity and potential conformational isomerism. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. Additionally, the methoxyphenyl group suggests potential aromatic interactions, which could play a role in its reactivity and binding properties in biological systems. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and functional groups that can interact with biological targets.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-14-7-3-5-12(10-14)15(17)9-11-4-2-6-13(8-11)16(18)19/h3,5,7,10-11,13H,2,4,6,8-9H2,1H3,(H,18,19)/t11-,13+/m0/s1