CAS 735275-14-6
:(1R,3S)-3-[2-(3-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-[2-(3-bromophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-14-6, is characterized by its unique structural features that include a cyclohexane ring and a carboxylic acid functional group. The presence of a bromophenyl moiety introduces significant hydrophobic characteristics, while the ketone functionality contributes to its reactivity and potential interactions in biological systems. This compound exhibits chirality, indicated by the (1R,3S) configuration, which can influence its pharmacological properties and interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both acidic and hydrophobic components that may enhance bioactivity. Additionally, the compound's stability and solubility can be influenced by the bromine substituent, which may affect its overall behavior in various chemical environments. Overall, this compound represents a complex structure with potential implications in drug design and development.
Formula:C15H17BrO3
InChI:InChI=1/C15H17BrO3/c16-13-6-2-4-11(9-13)14(17)8-10-3-1-5-12(7-10)15(18)19/h2,4,6,9-10,12H,1,3,5,7-8H2,(H,18,19)/t10-,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.