CAS 735275-18-0
:(1R,3S)-3-[2-(3-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-[2-(3-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-18-0, is a chiral compound characterized by its cyclohexane backbone and a carboxylic acid functional group. The presence of a fluorophenyl group introduces notable electronic and steric properties, which can influence its reactivity and interactions in biological systems. The specific stereochemistry indicated by the (1R,3S) configuration suggests that the compound may exhibit unique pharmacological properties, potentially making it of interest in medicinal chemistry. The carboxylic acid functionality contributes to its solubility in polar solvents and may play a role in hydrogen bonding interactions. Additionally, the presence of the keto group adjacent to the phenyl ring can enhance the compound's reactivity and stability. Overall, this compound's structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors.
Formula:C15H17FO3
InChI:InChI=1/C15H17FO3/c16-13-6-2-4-11(9-13)14(17)8-10-3-1-5-12(7-10)15(18)19/h2,4,6,9-10,12H,1,3,5,7-8H2,(H,18,19)/t10-,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.