CymitQuimica logo

CAS 735275-19-1

:

(1R,3S)-3-[2-(4-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-[2-(4-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-19-1, is a chiral compound characterized by its cyclohexane backbone, which features a carboxylic acid functional group. The presence of the 4-fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, contributing to its potential biological activity and lipophilicity. The compound's stereochemistry, denoted by the (1R,3S) configuration, suggests specific spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological targets. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds. Its unique structure may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the fluorine substitution can enhance metabolic stability or alter pharmacokinetic properties. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and drug development.
Formula:C15H17FO3
InChI:InChI=1/C15H17FO3/c16-13-6-4-11(5-7-13)14(17)9-10-2-1-3-12(8-10)15(18)19/h4-7,10,12H,1-3,8-9H2,(H,18,19)/t10-,12+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.