CAS 735275-20-4
:rel-(1R,3S)-3-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
Description:
Rel-(1R,3S)-3-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its specific stereochemistry and functional groups. It features a cyclohexane ring with a carboxylic acid group, which contributes to its acidity and potential reactivity. The presence of a bromophenyl moiety indicates that the compound may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic substitutions. The oxoethyl group suggests that it may also engage in reactions typical of carbonyl compounds, such as nucleophilic additions. The stereochemical configuration (1R,3S) implies that the compound has specific spatial arrangements that can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structure and potential biological activity. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, such as pH and solvent polarity.
Formula:C15H17BrO3
InChI:InChI=1/C15H17BrO3/c16-13-7-2-1-6-12(13)14(17)9-10-4-3-5-11(8-10)15(18)19/h1-2,6-7,10-11H,3-5,8-9H2,(H,18,19)/t10-,11+/s2
InChI key:InChIKey=WWBDHSIOGABKMI-WIBLRKLZNA-N
SMILES:C(C[C@H]1C[C@@H](C(O)=O)CCC1)(=O)C2=C(Br)C=CC=C2
Synonyms:- rel-(1R,3S)-3-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 3-[2-(2-bromophenyl)-2-oxoethyl]-, (1R,3S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.