CAS 735275-36-2
:(1R,3S)-3-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-[2-(2-fluorophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-36-2, is characterized by its specific stereochemistry, indicated by the (1R,3S) configuration. This compound features a cyclohexane ring, which contributes to its three-dimensional structure and potential interactions with biological targets. The presence of a carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in various environments. Additionally, the substitution of a fluorophenyl group and a keto group on the ethyl chain indicates potential for significant biological activity, possibly as a pharmaceutical agent. The fluorine atom can enhance lipophilicity and metabolic stability, making it a point of interest in drug design. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C15H17FO3
InChI:InChI=1/C15H17FO3/c16-13-7-2-1-6-12(13)14(17)9-10-4-3-5-11(8-10)15(18)19/h1-2,6-7,10-11H,3-5,8-9H2,(H,18,19)/t10-,11+/m0/s1
Synonyms:- Cyclohexanecarboxylic acid, 3-[2-(2-fluorophenyl)-2-oxoethyl]-, (1R,3S)-rel-
- CIS-3-[2-(2-FLUOROPHENYL)-2-OXOETHYL]CYCLOHEXANE-1-CARBOXYLIC ACID
- (1R,3S)-3-(2-(2-fluorophenyl)-2-oxoethyl)cyclohexane-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.