CAS 735275-37-3

(1R,3S)-3-[2-(2-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-(2-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-37-3, is characterized by its unique structural features and functional groups. It contains a cyclohexane ring, which contributes to its cyclic structure and potential conformational flexibility. The presence of a carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The molecule also features a 2-iodophenyl group, which introduces significant steric and electronic effects due to the iodine substituent, potentially influencing its reactivity and interactions with biological targets. The ketone functionality in the ethyl side chain adds to its reactivity, allowing for various chemical transformations. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its stereochemistry, indicated by the (1R,3S) configuration, suggests specific spatial arrangements that could affect its biological activity and interactions.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-13-7-2-1-6-12(13)14(17)9-10-4-3-5-11(8-10)15(18)19/h1-2,6-7,10-11H,3-5,8-9H2,(H,18,19)/t10-,11+/m0/s1