CAS 735275-38-4

(1R,3S)-3-[2-(3-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-(3-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-38-4, is a chiral compound featuring a cyclohexane ring substituted with a carboxylic acid group and an acyl side chain. Its structure includes a 3-iodophenyl moiety, which contributes to its potential biological activity and interactions. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The stereochemistry, denoted by the (1R,3S) configuration, suggests specific spatial arrangements that can influence the compound's reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of therapeutic agents. Additionally, the iodine atom in the structure may enhance the compound's lipophilicity and influence its metabolic stability. Overall, this compound represents a unique scaffold for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-13-6-2-4-11(9-13)14(17)8-10-3-1-5-12(7-10)15(18)19/h2,4,6,9-10,12H,1,3,5,7-8H2,(H,18,19)/t10-,12+/m0/s1