CAS 735275-39-5

(1R,3S)-3-[2-(4-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-[2-(4-iodophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-39-5, is a chiral compound characterized by its cyclohexane ring structure, which features a carboxylic acid functional group. The presence of the 4-iodophenyl group indicates that it has significant aromatic characteristics, contributing to its potential reactivity and biological activity. The compound's stereochemistry, denoted by the (1R,3S) configuration, suggests specific spatial arrangements of its atoms, which can influence its interactions in biological systems. This compound may exhibit properties such as solubility in organic solvents, potential for hydrogen bonding due to the carboxylic acid group, and possible applications in medicinal chemistry or as a building block in organic synthesis. Its unique structure may also confer specific pharmacological properties, making it of interest in drug development or research into new therapeutic agents.

Formula: C₁₅H₁₇IO₃

InChI: InChI=1/C15H17IO3/c16-13-6-4-11(5-7-13)14(17)9-10-2-1-3-12(8-10)15(18)19/h4-7,10,12H,1-3,8-9H2,(H,18,19)/t10-,12+/m0/s1