CAS 735275-40-8
:rel-(1R,3S)-3-[2-Oxo-2-[2-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid
Description:
Rel-(1R,3S)-3-[2-Oxo-2-[2-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid, with CAS number 735275-40-8, is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a trifluoromethyl-substituted phenyl group. This compound exhibits a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The stereochemistry indicated by the (1R,3S) configuration suggests specific spatial arrangements of atoms, which can significantly affect the compound's interactions with biological targets. Additionally, the ketone functionality within the molecule may participate in various chemical transformations, further expanding its utility in synthetic applications. Overall, this compound's distinctive features make it a subject of interest in medicinal chemistry and related fields.
Formula:C16H17F3O3
InChI:InChI=1/C16H17F3O3/c17-16(18,19)13-7-2-1-6-12(13)14(20)9-10-4-3-5-11(8-10)15(21)22/h1-2,6-7,10-11H,3-5,8-9H2,(H,21,22)/t10-,11+/s2
InChI key:InChIKey=GQXBAYXYFBWKJZ-WIBLRKLZNA-N
SMILES:C(C[C@H]1C[C@@H](C(O)=O)CCC1)(=O)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- rel-(1R,3S)-3-[2-Oxo-2-[2-(trifluoromethyl)phenyl]ethyl]cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 3-[2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl]-, (1R,3S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.