CAS 735275-43-1
:(1R,3S)-3-[2-(2-nitrophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-[2-(2-nitrophenyl)-2-oxo-ethyl]cyclohexane-1-carboxylic acid, with the CAS number 735275-43-1, is characterized by its complex structure that includes a cyclohexane ring substituted with a carboxylic acid group and a nitrophenyl moiety. This compound features stereocenters, which contribute to its chiral nature, influencing its biological activity and interactions. The presence of the nitrophenyl group suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of pharmaceuticals. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Additionally, the compound's nitro group may impart specific electronic properties, affecting its reactivity and interaction with biological targets. Overall, this substance's unique structural features and functional groups make it a candidate for further investigation in various chemical and biological contexts.
Formula:C15H17NO5
InChI:InChI=1/C15H17NO5/c17-14(12-6-1-2-7-13(12)16(20)21)9-10-4-3-5-11(8-10)15(18)19/h1-2,6-7,10-11H,3-5,8-9H2,(H,18,19)/t10-,11+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.