CymitQuimica logo

CAS 735275-47-5

:

cis-4-[2-(2-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:
Cis-4-[2-(2-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a carboxylic acid functional group. The presence of the cis configuration indicates that specific substituents on the cyclohexane are oriented on the same side, which can influence the compound's physical and chemical properties, such as its boiling and melting points, solubility, and reactivity. The compound also contains a ketone functional group due to the 2-oxoethyl substituent, which may contribute to its reactivity and potential applications in organic synthesis or pharmaceuticals. The presence of the 2-methylphenyl group adds to its complexity and may affect its interactions with biological systems. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique structure could lead to specific biological activities or material properties.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-11-4-2-3-5-14(11)15(17)10-12-6-8-13(9-7-12)16(18)19/h2-5,12-13H,6-10H2,1H3,(H,18,19)/t12-,13+
InChI key:InChIKey=MYZMHUJRWLKOFK-BETUJISGNA-N
SMILES:C(C(=O)C1=C(C)C=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2
Synonyms:
  • cis-4-[2-(2-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid
  • Cyclohexanecarboxylic acid, 4-[2-(2-methylphenyl)-2-oxoethyl]-, cis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.