CAS 735275-48-6

cis-4-[2-(3-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(3-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a carboxylic acid functional group. The presence of the 3-methylphenyl group contributes to its aromatic properties, while the oxoethyl substituent introduces a ketone functionality. This compound is typically studied for its potential applications in pharmaceuticals and organic synthesis due to its ability to participate in various chemical reactions, such as esterification and amidation. The cis configuration indicates that the substituents on the cyclohexane ring are oriented on the same side, which can influence the compound's reactivity and physical properties, such as solubility and melting point. Additionally, the carboxylic acid group can engage in hydrogen bonding, affecting its interactions in biological systems. Overall, this compound exemplifies the complexity and diversity of organic molecules, making it a subject of interest in both academic and industrial research.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-11-3-2-4-14(9-11)15(17)10-12-5-7-13(8-6-12)16(18)19/h2-4,9,12-13H,5-8,10H2,1H3,(H,18,19)/t12-,13+

InChI key: InChIKey=LQEPLZMZOHBRGP-BETUJISGNA-N

SMILES: C(C[C@H]1CC[C@@H](C(O)=O)CC1)(=O)C2=CC(C)=CC=C2

Synonyms:

• cis-4-[2-(3-Methylphenyl)-2-oxoethyl]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-[2-(3-methylphenyl)-2-oxoethyl]-, cis-