CAS 735275-50-0

cis-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a carboxylic acid functional group. The presence of the methoxyphenyl group contributes to its aromatic properties, while the ketone functionality (2-oxo) indicates potential reactivity in various chemical processes. The "cis" configuration suggests that specific substituents on the cyclohexane ring are oriented on the same side, which can influence the compound's spatial arrangement and, consequently, its physical and chemical properties, such as solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions could be studied for potential applications in drug development or as a biochemical probe. As with many organic compounds, the stability, reactivity, and interactions of cis-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid can be influenced by environmental conditions such as pH, temperature, and the presence of other chemical species.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-15-5-3-2-4-13(15)14(17)10-11-6-8-12(9-7-11)16(18)19/h2-5,11-12H,6-10H2,1H3,(H,18,19)/t11-,12+

InChI key: InChIKey=YALZQBZQWJJHEI-TXEJJXNPNA-N

SMILES: C(C[C@H]1CC[C@@H](C(O)=O)CC1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-[2-(2-methoxyphenyl)-2-oxoethyl]-, cis-
• cis-4-[2-(2-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid