CAS 735275-52-2

cis-4-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a carboxylic acid functional group. The presence of the methoxyphenyl group contributes to its aromatic properties, while the ketone functionality (2-oxo) enhances its reactivity. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The cis configuration indicates that specific substituents on the cyclohexane ring are oriented on the same side, which can influence the compound's spatial arrangement and, consequently, its biological activity. Additionally, the carboxylic acid group may impart acidic properties, affecting solubility and reactivity in various environments. Overall, the compound's unique structure and functional groups make it a subject of interest in chemical research and drug development.

Formula: C₁₆H₂₀O₄

InChI: InChI=1/C16H20O4/c1-20-14-8-6-12(7-9-14)15(17)10-11-2-4-13(5-3-11)16(18)19/h6-9,11,13H,2-5,10H2,1H3,(H,18,19)/t11-,13+

InChI key: InChIKey=LNNJSFXWTHGRAD-BJHJDKERNA-N

SMILES: C(C(=O)C1=CC=C(OC)C=C1)[C@H]2CC[C@@H](C(O)=O)CC2

Synonyms:

• Cyclohexanecarboxylic acid, 4-[2-(4-methoxyphenyl)-2-oxoethyl]-, cis-
• cis-4-[2-(4-Methoxyphenyl)-2-oxoethyl]cyclohexanecarboxylic acid