CAS 735275-56-6

cis-4-[2-(3-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:

Cis-4-[2-(3-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a carboxylic acid functional group. The presence of a bromophenyl moiety introduces significant polarity and potential for various interactions, influencing its reactivity and solubility. The cis configuration of the substituents around the cyclohexane ring affects the compound's three-dimensional shape, which can impact its biological activity and interactions with other molecules. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can enhance its solubility in polar solvents. Additionally, the presence of the bromine atom may contribute to its reactivity, making it a candidate for further chemical transformations. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological or pharmacological data would be necessary to fully understand its utility.

Formula: C₁₅H₁₇BrO₃

InChI: InChI=1/C15H17BrO3/c16-13-3-1-2-12(9-13)14(17)8-10-4-6-11(7-5-10)15(18)19/h1-3,9-11H,4-8H2,(H,18,19)/t10-,11+

InChI key: InChIKey=COTXSNAGEWJUML-PHIMTYICNA-N

SMILES: C(C[C@H]1CC[C@@H](C(O)=O)CC1)(=O)C2=CC(Br)=CC=C2

Synonyms:

• Cyclohexanecarboxylic acid, 4-[2-(3-bromophenyl)-2-oxoethyl]-, cis-
• cis-4-[2-(3-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid