CAS 735275-58-8
:cis-4-[2-(3-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
Description:
Cis-4-[2-(3-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclohexane ring and a carboxylic acid functional group. The presence of a 3-chlorophenyl group and a keto group contributes to its reactivity and potential biological activity. This compound is typically studied in the context of medicinal chemistry due to its structural similarities to other bioactive molecules. Its cis configuration indicates that specific substituents are oriented on the same side of the cyclohexane ring, which can influence its physical properties, such as solubility and melting point. The carboxylic acid group is known for its acidity and ability to form hydrogen bonds, which can enhance interactions with biological targets. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C15H17ClO3
InChI:InChI=1/C15H17ClO3/c16-13-3-1-2-12(9-13)14(17)8-10-4-6-11(7-5-10)15(18)19/h1-3,9-11H,4-8H2,(H,18,19)/t10-,11+
InChI key:InChIKey=NYTRSJIUYQSYKZ-PHIMTYICNA-N
SMILES:C(C[C@H]1CC[C@@H](C(O)=O)CC1)(=O)C2=CC(Cl)=CC=C2
Synonyms:- Cyclohexanecarboxylic acid, 4-[2-(3-chlorophenyl)-2-oxoethyl]-, cis-
- cis-4-[2-(3-Chlorophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.