CymitQuimica logo

CAS 735275-62-4

:

cis-4-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid

Description:
Cis-4-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structural features, including a cyclohexane ring and a carboxylic acid functional group. The presence of a bromophenyl moiety contributes to its potential reactivity and biological activity. This compound is likely to exhibit specific stereochemical properties due to the "cis" configuration, which can influence its interactions with biological targets. The carboxylic acid group imparts acidic characteristics, allowing for potential solubility in polar solvents and participation in acid-base reactions. Additionally, the presence of the ketone functionality (2-oxoethyl) suggests potential for further chemical transformations. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and the presence of halogen substituents, which can enhance biological activity. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological applications.
Formula:C15H17BrO3
InChI:InChI=1/C15H17BrO3/c16-13-4-2-1-3-12(13)14(17)9-10-5-7-11(8-6-10)15(18)19/h1-4,10-11H,5-9H2,(H,18,19)/t10-,11+
InChI key:InChIKey=ALNIXWJGPRLYLB-PHIMTYICNA-N
SMILES:C(C(=O)C1=C(Br)C=CC=C1)[C@H]2CC[C@@H](C(O)=O)CC2
Synonyms:
  • cis-4-[2-(2-Bromophenyl)-2-oxoethyl]cyclohexanecarboxylic acid
  • Cyclohexanecarboxylic acid, 4-[2-(2-bromophenyl)-2-oxoethyl]-, cis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.